C26H35ClN2O4 — CID 71523982
(5S)-5-[6-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)hexylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride (PubChem CID 71523982) has the molecular formula C26H35ClN2O4 and a molecular weight of 475.03 g/mol. Its IUPAC name is (5S)-5-[6-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)hexylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | (5S)-5-[6-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)hexylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 71523982 |
| Molecular Formula | C26H35ClN2O4 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | (5S)-5-[6-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)hexylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CCCCCCN[C@H]1CCCc3[nH]c(=O)ccc31)C2.Cl |
| InChI | InChI=1S/C26H34N2O4.ClH/c1-31-23-15-18-14-17(26(30)20(18)16-24(23)32-2)8-5-3-4-6-13-27-21-9-7-10-22-19(21)11-12-25(29)28-22;/h11-12,15-17,21,27H,3-10,13-14H2,1-2H3,(H,28,29);1H/t17?,21-;/m0./s1 |
| InChIKey | UJIYKYOJVJZGLO-LNWQMJQJSA-N |
| XLogP | 4.79 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|