C27H37ClN2O4 — CID 71523986
(5S)-5-[7-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)heptylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride (PubChem CID 71523986) has the molecular formula C27H37ClN2O4 and a molecular weight of 489.06 g/mol. Its IUPAC name is (5S)-5-[7-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)heptylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | (5S)-5-[7-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)heptylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 71523986 |
| Molecular Formula | C27H37ClN2O4 |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (5S)-5-[7-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)heptylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CCCCCCCN[C@H]1CCCc3[nH]c(=O)ccc31)C2.Cl |
| InChI | InChI=1S/C27H36N2O4.ClH/c1-32-24-16-19-15-18(27(31)21(19)17-25(24)33-2)9-6-4-3-5-7-14-28-22-10-8-11-23-20(22)12-13-26(30)29-23;/h12-13,16-18,22,28H,3-11,14-15H2,1-2H3,(H,29,30);1H/t18?,22-;/m0./s1 |
| InChIKey | GZXWKWCEVCKVSP-KJIPLLCSSA-N |
| XLogP | 5.18 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|