C29H41ClN2O4 — CID 71523990
(5S)-5-[9-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)nonylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride (PubChem CID 71523990) has the molecular formula C29H41ClN2O4 and a molecular weight of 517.11 g/mol. Its IUPAC name is (5S)-5-[9-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)nonylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | (5S)-5-[9-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)nonylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 71523990 |
| Molecular Formula | C29H41ClN2O4 |
| Molecular Weight | 517.11 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | (5S)-5-[9-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)nonylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CCCCCCCCCN[C@H]1CCCc3[nH]c(=O)ccc31)C2.Cl |
| InChI | InChI=1S/C29H40N2O4.ClH/c1-34-26-18-21-17-20(29(33)23(21)19-27(26)35-2)11-8-6-4-3-5-7-9-16-30-24-12-10-13-25-22(24)14-15-28(32)31-25;/h14-15,18-20,24,30H,3-13,16-17H2,1-2H3,(H,31,32);1H/t20?,24-;/m0./s1 |
| InChIKey | BIYMSSSOIDZZFF-ZAXUKBGBSA-N |
| XLogP | 5.96 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.11 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|