About 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol
2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol (PubChem CID 71524013) has the molecular formula C23H20N8O2
and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol.
Molecular Properties
| Compound Name | 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol |
| PubChem CID | 71524013 |
| Molecular Formula | C23H20N8O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol |
| SMILES | Cc1cc(-c2ccc(-c3nn[nH]n3)cc2)c(OCCO)c(-c2ccc(-c3nn[nH]n3)cc2)c1 |
| InChI | InChI=1S/C23H20N8O2/c1-14-12-19(15-2-6-17(7-3-15)22-24-28-29-25-22)21(33-11-10-32)20(13-14)16-4-8-18(9-5-16)23-26-30-31-27-23/h2-9,12-13,32H,10-11H2,1H3,(H,24,25,28,29)(H,26,27,30,31) |
| InChIKey | CIGFGSRIBWJNFN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol?
The IUPAC name of 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol (CID 71524013) is 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol.
What is the SMILES notation for 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol?
The canonical SMILES for 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol is Cc1cc(-c2ccc(-c3nn[nH]n3)cc2)c(OCCO)c(-c2ccc(-c3nn[nH]n3)cc2)c1.
What is the InChIKey of 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol?
The InChIKey is CIGFGSRIBWJNFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N8O2/c1-14-12-19(15-2-6-17(7-3-15)22-24-28-29-25-22)21(33-11-10-32)20(13-14)16-4-8-18(9-5-16)23-26-30-31-27-23/h2-9,12-13,32H,10-11H2,1H3,(H,24,25,28,29)(H,26,27,30,31).
What are the key properties of 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol?
2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol has a molecular weight of 440.47 g/mol, XLogP of 3.06, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methyl-2,6-bis[4-(2H-tetrazol-5-yl)phenyl]phenoxy]ethanol is sourced from PubChem (CID 71524013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).