About 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride
2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride (PubChem CID 71524087) has the molecular formula C16H14ClNO3
and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride.
Molecular Properties
| Compound Name | 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride |
| PubChem CID | 71524087 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride |
| SMILES | COc1ccc2c(c1)c1cc3c(cc1c[n+]2C)OCO3.[Cl-] |
| InChI | InChI=1S/C16H14NO3.ClH/c1-17-8-10-5-15-16(20-9-19-15)7-12(10)13-6-11(18-2)3-4-14(13)17;/h3-8H,9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BWGIUNMXTMOHFV-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride?
The IUPAC name of 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride (CID 71524087) is 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride.
What is the SMILES notation for 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride?
The canonical SMILES for 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride is COc1ccc2c(c1)c1cc3c(cc1c[n+]2C)OCO3.[Cl-].
What is the InChIKey of 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride?
The InChIKey is BWGIUNMXTMOHFV-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H14NO3.ClH/c1-17-8-10-5-15-16(20-9-19-15)7-12(10)13-6-11(18-2)3-4-14(13)17;/h3-8H,9H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride?
2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride has a molecular weight of 303.75 g/mol, XLogP of -0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-methyl-[1,3]dioxolo[4,5-j]phenanthridin-5-ium chloride is sourced from PubChem (CID 71524087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).