About methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate
methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate (PubChem CID 71524328) has the molecular formula C15H17Cl2NO3
and a molecular weight of 330.21 g/mol. Its IUPAC name is methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate.
Molecular Properties
| Compound Name | methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate |
| PubChem CID | 71524328 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate |
| SMILES | C=CCN(CC(O)C(=C)C(=O)OC)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2NO3/c1-4-5-18(9-14(19)10(2)15(20)21-3)13-7-11(16)6-12(17)8-13/h4,6-8,14,19H,1-2,5,9H2,3H3 |
| InChIKey | NBFKIJYOQPIENG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate?
The IUPAC name of methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate (CID 71524328) is methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate.
What is the SMILES notation for methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate?
The canonical SMILES for methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate is C=CCN(CC(O)C(=C)C(=O)OC)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate?
The InChIKey is NBFKIJYOQPIENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2NO3/c1-4-5-18(9-14(19)10(2)15(20)21-3)13-7-11(16)6-12(17)8-13/h4,6-8,14,19H,1-2,5,9H2,3H3.
What are the key properties of methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate?
methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate has a molecular weight of 330.21 g/mol, XLogP of 3.08, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,5-dichloro-N-prop-2-enylanilino)-3-hydroxy-2-methylidenebutanoate is sourced from PubChem (CID 71524328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).