C16H22O3 — CID 71524428
[(1R,3S,7R,8R,9R)-7,10,10-trimethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate (PubChem CID 71524428) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is [(1R,3S,7R,8R,9R)-7,10,10-trimethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate.
| Compound Name | [(1R,3S,7R,8R,9R)-7,10,10-trimethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate |
|---|---|
| PubChem CID | 71524428 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [(1R,3S,7R,8R,9R)-7,10,10-trimethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@H](CC1(C)C)C1C3C(=O)C[C@]2(C)[C@H]31 |
| InChI | InChI=1S/C16H22O3/c1-7(17)19-14-12-8(5-15(14,2)3)10-11-9(18)6-16(12,4)13(10)11/h8,10-14H,5-6H2,1-4H3/t8-,10?,11?,12+,13+,14-,16+/m1/s1 |
| InChIKey | GNMSLIMGQFPJDQ-AZGZCVNWSA-N |
| XLogP | 2.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |