C28H34N4O6 — CID 71524578
4-methyl-5-[2-(3,4,5-trimethoxyphenyl)ethyl]-7-[(3,4,5-trimethoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 71524578) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is 4-methyl-5-[2-(3,4,5-trimethoxyphenyl)ethyl]-7-[(3,4,5-trimethoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-methyl-5-[2-(3,4,5-trimethoxyphenyl)ethyl]-7-[(3,4,5-trimethoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 71524578 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 4-methyl-5-[2-(3,4,5-trimethoxyphenyl)ethyl]-7-[(3,4,5-trimethoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | COc1cc(CCc2cn(Cc3cc(OC)c(OC)c(OC)c3)c3nc(N)nc(C)c23)cc(OC)c1OC |
| InChI | InChI=1S/C28H34N4O6/c1-16-24-19(9-8-17-10-20(33-2)25(37-6)21(11-17)34-3)15-32(27(24)31-28(29)30-16)14-18-12-22(35-4)26(38-7)23(13-18)36-5/h10-13,15H,8-9,14H2,1-7H3,(H2,29,30,31) |
| InChIKey | XALMYFGJXCPMKR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |