C15H22ClN2O5P — CID 71524675
(3R,5R)-N-(4-chlorophenyl)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidine-5-carboxamide (PubChem CID 71524675) has the molecular formula C15H22ClN2O5P and a molecular weight of 376.78 g/mol. Its IUPAC name is (3R,5R)-N-(4-chlorophenyl)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidine-5-carboxamide.
| Compound Name | (3R,5R)-N-(4-chlorophenyl)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71524675 |
| Molecular Formula | C15H22ClN2O5P |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (3R,5R)-N-(4-chlorophenyl)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidine-5-carboxamide |
| SMILES | CCOP(=O)(OCC)[C@@H]1C[C@H](C(=O)Nc2ccc(Cl)cc2)ON1C |
| InChI | InChI=1S/C15H22ClN2O5P/c1-4-21-24(20,22-5-2)14-10-13(23-18(14)3)15(19)17-12-8-6-11(16)7-9-12/h6-9,13-14H,4-5,10H2,1-3H3,(H,17,19)/t13-,14-/m1/s1 |
| InChIKey | WNNGOPCWCRECEL-ZIAGYGMSSA-N |
| XLogP | 3.51 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|