C19H22O5 — CID 71524985
2-methoxy-5-[(1S,2R)-2-(3,4,5-trimethoxyphenyl)cyclopropyl]phenol (PubChem CID 71524985) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-methoxy-5-[(1S,2R)-2-(3,4,5-trimethoxyphenyl)cyclopropyl]phenol.
| Compound Name | 2-methoxy-5-[(1S,2R)-2-(3,4,5-trimethoxyphenyl)cyclopropyl]phenol |
|---|---|
| PubChem CID | 71524985 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-methoxy-5-[(1S,2R)-2-(3,4,5-trimethoxyphenyl)cyclopropyl]phenol |
| SMILES | COc1ccc([C@H]2C[C@H]2c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C19H22O5/c1-21-16-6-5-11(7-15(16)20)13-10-14(13)12-8-17(22-2)19(24-4)18(9-12)23-3/h5-9,13-14,20H,10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | UDGSMCKILRWBIJ-KGLIPLIRSA-N |
| XLogP | 3.70 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |