About (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate
(4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate (PubChem CID 71525049) has the molecular formula C36H22O8
and a molecular weight of 582.56 g/mol. Its IUPAC name is (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate.
Molecular Properties
| Compound Name | (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate |
| PubChem CID | 71525049 |
| Molecular Formula | C36H22O8 |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate |
| SMILES | O=C(OCc1cc(OC(=O)c2ccccc2)c2c(c1)C(=O)c1cccc(OC(=O)c3ccccc3)c1C2=O)c1ccccc1 |
| InChI | InChI=1S/C36H22O8/c37-32-26-17-10-18-28(43-35(40)24-13-6-2-7-14-24)30(26)33(38)31-27(32)19-22(21-42-34(39)23-11-4-1-5-12-23)20-29(31)44-36(41)25-15-8-3-9-16-25/h1-20H,21H2 |
| InChIKey | ZRHSKQVZTGDTIQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate?
The IUPAC name of (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate (CID 71525049) is (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate.
What is the SMILES notation for (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate?
The canonical SMILES for (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate is O=C(OCc1cc(OC(=O)c2ccccc2)c2c(c1)C(=O)c1cccc(OC(=O)c3ccccc3)c1C2=O)c1ccccc1.
What is the InChIKey of (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate?
The InChIKey is ZRHSKQVZTGDTIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H22O8/c37-32-26-17-10-18-28(43-35(40)24-13-6-2-7-14-24)30(26)33(38)31-27(32)19-22(21-42-34(39)23-11-4-1-5-12-23)20-29(31)44-36(41)25-15-8-3-9-16-25/h1-20H,21H2.
What are the key properties of (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate?
(4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate has a molecular weight of 582.56 g/mol, XLogP of 6.26, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dibenzoyloxy-9,10-dioxoanthracen-2-yl)methyl benzoate is sourced from PubChem (CID 71525049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).