About 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride
1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride (PubChem CID 71525091) has the molecular formula C20H14ClNO4
and a molecular weight of 367.79 g/mol. Its IUPAC name is 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride.
Molecular Properties
| Compound Name | 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride |
| PubChem CID | 71525091 |
| Molecular Formula | C20H14ClNO4 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cc(C[n+]3ccccc3)cc21.[Cl-] |
| InChI | InChI=1S/C20H13NO4.ClH/c22-15-6-4-5-13-17(15)20(25)18-14(19(13)24)9-12(10-16(18)23)11-21-7-2-1-3-8-21;/h1-10H,11H2,(H-,22,23,25);1H |
| InChIKey | AGBKPHKEUANBSI-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride?
The IUPAC name of 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride (CID 71525091) is 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride.
What is the SMILES notation for 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride?
The canonical SMILES for 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride is O=C1c2cccc(O)c2C(=O)c2c(O)cc(C[n+]3ccccc3)cc21.[Cl-].
What is the InChIKey of 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride?
The InChIKey is AGBKPHKEUANBSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13NO4.ClH/c22-15-6-4-5-13-17(15)20(25)18-14(19(13)24)9-12(10-16(18)23)11-21-7-2-1-3-8-21;/h1-10H,11H2,(H-,22,23,25);1H.
What are the key properties of 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride?
1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride has a molecular weight of 367.79 g/mol, XLogP of -0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dihydroxy-3-(pyridin-1-ium-1-ylmethyl)anthracene-9,10-dione chloride is sourced from PubChem (CID 71525091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).