About (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride
(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride (PubChem CID 71525093) has the molecular formula C18H18ClNO4
and a molecular weight of 347.80 g/mol. Its IUPAC name is (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride.
Molecular Properties
| Compound Name | (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride |
| PubChem CID | 71525093 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)Cc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.[Cl-] |
| InChI | InChI=1S/C18H17NO4.ClH/c1-19(2,3)9-10-7-12-16(14(21)8-10)18(23)15-11(17(12)22)5-4-6-13(15)20;/h4-8H,9H2,1-3H3,(H-,20,21,23);1H |
| InChIKey | MTTDFIHSJCVZRW-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride?
The IUPAC name of (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride (CID 71525093) is (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride.
What is the SMILES notation for (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride?
The canonical SMILES for (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride is C[N+](C)(C)Cc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.[Cl-].
What is the InChIKey of (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride?
The InChIKey is MTTDFIHSJCVZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4.ClH/c1-19(2,3)9-10-7-12-16(14(21)8-10)18(23)15-11(17(12)22)5-4-6-13(15)20;/h4-8H,9H2,1-3H3,(H-,20,21,23);1H.
What are the key properties of (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride?
(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride has a molecular weight of 347.80 g/mol, XLogP of -0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-trimethylazanium chloride is sourced from PubChem (CID 71525093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).