C10H17NO2 — CID 71525173
(1R,2R,6S)-6-(3-aminoprop-1-en-2-yl)-3-methylcyclohex-3-ene-1,2-diol (PubChem CID 71525173) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (1R,2R,6S)-6-(3-aminoprop-1-en-2-yl)-3-methylcyclohex-3-ene-1,2-diol.
| Compound Name | (1R,2R,6S)-6-(3-aminoprop-1-en-2-yl)-3-methylcyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 71525173 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (1R,2R,6S)-6-(3-aminoprop-1-en-2-yl)-3-methylcyclohex-3-ene-1,2-diol |
| SMILES | C=C(CN)[C@@H]1CC=C(C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H17NO2/c1-6-3-4-8(7(2)5-11)10(13)9(6)12/h3,8-10,12-13H,2,4-5,11H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | KRCIKGNDRNIJJW-IVZWLZJFSA-N |
| XLogP | 0.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|