C14H24O2 — CID 71525178
(1R,2R,6S)-6-hept-1-en-2-yl-3-methylcyclohex-3-ene-1,2-diol (PubChem CID 71525178) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (1R,2R,6S)-6-hept-1-en-2-yl-3-methylcyclohex-3-ene-1,2-diol.
| Compound Name | (1R,2R,6S)-6-hept-1-en-2-yl-3-methylcyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 71525178 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (1R,2R,6S)-6-hept-1-en-2-yl-3-methylcyclohex-3-ene-1,2-diol |
| SMILES | C=C(CCCCC)[C@@H]1CC=C(C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H24O2/c1-4-5-6-7-10(2)12-9-8-11(3)13(15)14(12)16/h8,12-16H,2,4-7,9H2,1,3H3/t12-,13+,14+/m0/s1 |
| InChIKey | AXJPQODPACCMFO-BFHYXJOUSA-N |
| XLogP | 2.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|