C13H22O2S — CID 71525225
(1R,2R,6S)-3-methyl-6-(3-propylsulfanylprop-1-en-2-yl)cyclohex-3-ene-1,2-diol (PubChem CID 71525225) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is (1R,2R,6S)-3-methyl-6-(3-propylsulfanylprop-1-en-2-yl)cyclohex-3-ene-1,2-diol.
| Compound Name | (1R,2R,6S)-3-methyl-6-(3-propylsulfanylprop-1-en-2-yl)cyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 71525225 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (1R,2R,6S)-3-methyl-6-(3-propylsulfanylprop-1-en-2-yl)cyclohex-3-ene-1,2-diol |
| SMILES | C=C(CSCCC)[C@@H]1CC=C(C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H22O2S/c1-4-7-16-8-10(3)11-6-5-9(2)12(14)13(11)15/h5,11-15H,3-4,6-8H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | NGTKTKUQVWZEJL-YNEHKIRRSA-N |
| XLogP | 2.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|