C26H30O9 — CID 71525255
2,2-dimethyl-3-[[(1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-3H-benzo[g][1]benzofuran-4,5-dione (PubChem CID 71525255) has the molecular formula C26H30O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[(1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-3H-benzo[g][1]benzofuran-4,5-dione.
| Compound Name | 2,2-dimethyl-3-[[(1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-3H-benzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 71525255 |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2,2-dimethyl-3-[[(1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]-3H-benzo[g][1]benzofuran-4,5-dione |
| SMILES | CC1(C)O[C@@H]2O[C@@H](COC3C4=C(OC3(C)C)c3ccccc3C(=O)C4=O)[C@H]3OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C26H30O9/c1-24(2)22(15-17(28)16(27)12-9-7-8-10-13(12)18(15)31-24)29-11-14-19-20(33-25(3,4)32-19)21-23(30-14)35-26(5,6)34-21/h7-10,14,19-23H,11H2,1-6H3/t14-,19+,20+,21-,22?,23-/m0/s1 |
| InChIKey | GYARFLWMYFKNBZ-ADFNPOGKSA-N |
| XLogP | 2.75 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|