About (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide
(2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide (PubChem CID 71525272) has the molecular formula C22H42N2O
and a molecular weight of 350.59 g/mol. Its IUPAC name is (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide.
Molecular Properties
| Compound Name | (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide |
| PubChem CID | 71525272 |
| Molecular Formula | C22H42N2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.33 |
| IUPAC Name | (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)NCCCCCCCCCCCCN |
| InChI | InChI=1S/C22H42N2O/c1-20(2)15-14-16-21(3)19-22(25)24-18-13-11-9-7-5-4-6-8-10-12-17-23/h15,19H,4-14,16-18,23H2,1-3H3,(H,24,25)/b21-19+ |
| InChIKey | UBFOUUNYDUKYIU-XUTLUUPISA-N |
| XLogP | 5.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide?
The IUPAC name of (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide (CID 71525272) is (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide.
What is the SMILES notation for (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide?
The canonical SMILES for (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide is CC(C)=CCC/C(C)=C/C(=O)NCCCCCCCCCCCCN.
What is the InChIKey of (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide?
The InChIKey is UBFOUUNYDUKYIU-XUTLUUPISA-N. The full InChI is InChI=1S/C22H42N2O/c1-20(2)15-14-16-21(3)19-22(25)24-18-13-11-9-7-5-4-6-8-10-12-17-23/h15,19H,4-14,16-18,23H2,1-3H3,(H,24,25)/b21-19+.
What are the key properties of (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide?
(2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide has a molecular weight of 350.59 g/mol, XLogP of 5.66, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-(12-aminododecyl)-3,7-dimethylocta-2,6-dienamide is sourced from PubChem (CID 71525272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).