C20H38N2O3 — CID 71525273
(2E)-N-[3-[4-(3-aminopropoxy)butoxy]propyl]-3,7-dimethylocta-2,6-dienamide (PubChem CID 71525273) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is (2E)-N-[3-[4-(3-aminopropoxy)butoxy]propyl]-3,7-dimethylocta-2,6-dienamide.
| Compound Name | (2E)-N-[3-[4-(3-aminopropoxy)butoxy]propyl]-3,7-dimethylocta-2,6-dienamide |
|---|---|
| PubChem CID | 71525273 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | (2E)-N-[3-[4-(3-aminopropoxy)butoxy]propyl]-3,7-dimethylocta-2,6-dienamide |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)NCCCOCCCCOCCCN |
| InChI | InChI=1S/C20H38N2O3/c1-18(2)9-6-10-19(3)17-20(23)22-12-8-16-25-14-5-4-13-24-15-7-11-21/h9,17H,4-8,10-16,21H2,1-3H3,(H,22,23)/b19-17+ |
| InChIKey | BZUXSGRJDSJBKW-HTXNQAPBSA-N |
| XLogP | 3.35 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|