C26H20F9NO2 — CID 71525549
(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(cyclopenten-1-yl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 71525549) has the molecular formula C26H20F9NO2 and a molecular weight of 549.43 g/mol. Its IUPAC name is (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(cyclopenten-1-yl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(cyclopenten-1-yl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 71525549 |
| Molecular Formula | C26H20F9NO2 |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(cyclopenten-1-yl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | O=C1O[C@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@@H]2CC[C@@H](c3cc(C(F)(F)F)ccc3C3=CCCC3)N12 |
| InChI | InChI=1S/C26H20F9NO2/c27-24(28,29)15-5-6-18(13-3-1-2-4-13)19(12-15)20-7-8-21-22(38-23(37)36(20)21)14-9-16(25(30,31)32)11-17(10-14)26(33,34)35/h3,5-6,9-12,20-22H,1-2,4,7-8H2/t20-,21-,22+/m0/s1 |
| InChIKey | CXQCYKXZNWAVQF-FDFHNCONSA-N |
| XLogP | 8.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |