C27H16F11NO2 — CID 71525552
(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(2,5-difluorophenyl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 71525552) has the molecular formula C27H16F11NO2 and a molecular weight of 595.41 g/mol. Its IUPAC name is (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(2,5-difluorophenyl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(2,5-difluorophenyl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 71525552 |
| Molecular Formula | C27H16F11NO2 |
| Molecular Weight | 595.41 g/mol |
| Exact Mass | 595.10 |
| IUPAC Name | (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(2,5-difluorophenyl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | O=C1O[C@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@@H]2CC[C@@H](c3cc(C(F)(F)F)ccc3-c3cc(F)ccc3F)N12 |
| InChI | InChI=1S/C27H16F11NO2/c28-16-2-4-20(29)18(11-16)17-3-1-13(25(30,31)32)10-19(17)21-5-6-22-23(41-24(40)39(21)22)12-7-14(26(33,34)35)9-15(8-12)27(36,37)38/h1-4,7-11,21-23H,5-6H2/t21-,22-,23+/m0/s1 |
| InChIKey | HQQMGKUIDAPPPF-RJGXRXQPSA-N |
| XLogP | 9.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.41 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |