About 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine
7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 71525678) has the molecular formula C13H18N6
and a molecular weight of 258.33 g/mol. Its IUPAC name is 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine |
| PubChem CID | 71525678 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CCc1cnc2c(N3CC(NC)C3)nc(N)nc2c1 |
| InChI | InChI=1S/C13H18N6/c1-3-8-4-10-11(16-5-8)12(18-13(14)17-10)19-6-9(7-19)15-2/h4-5,9,15H,3,6-7H2,1-2H3,(H2,14,17,18) |
| InChIKey | PREVTMRNRJIUDH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine?
The IUPAC name of 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine (CID 71525678) is 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine is CCc1cnc2c(N3CC(NC)C3)nc(N)nc2c1.
What is the InChIKey of 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine?
The InChIKey is PREVTMRNRJIUDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N6/c1-3-8-4-10-11(16-5-8)12(18-13(14)17-10)19-6-9(7-19)15-2/h4-5,9,15H,3,6-7H2,1-2H3,(H2,14,17,18).
What are the key properties of 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine?
7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine has a molecular weight of 258.33 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-4-[3-(methylamino)azetidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 71525678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).