About 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine
7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 71525680) has the molecular formula C15H20N6
and a molecular weight of 284.37 g/mol. Its IUPAC name is 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine |
| PubChem CID | 71525680 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CN[C@@H]1CCN(c2nc(N)nc3cc(C4CC4)cnc23)C1 |
| InChI | InChI=1S/C15H20N6/c1-17-11-4-5-21(8-11)14-13-12(19-15(16)20-14)6-10(7-18-13)9-2-3-9/h6-7,9,11,17H,2-5,8H2,1H3,(H2,16,19,20)/t11-/m1/s1 |
| InChIKey | NPSDVAVEQMHDSG-LLVKDONJSA-N |
| XLogP | 1.28 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine?
The IUPAC name of 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine (CID 71525680) is 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine is CN[C@@H]1CCN(c2nc(N)nc3cc(C4CC4)cnc23)C1.
What is the InChIKey of 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine?
The InChIKey is NPSDVAVEQMHDSG-LLVKDONJSA-N. The full InChI is InChI=1S/C15H20N6/c1-17-11-4-5-21(8-11)14-13-12(19-15(16)20-14)6-10(7-18-13)9-2-3-9/h6-7,9,11,17H,2-5,8H2,1H3,(H2,16,19,20)/t11-/m1/s1.
What are the key properties of 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine?
7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine has a molecular weight of 284.37 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropyl-4-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 71525680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).