About N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine
N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine (PubChem CID 71525990) has the molecular formula C19H17N5O2
and a molecular weight of 347.38 g/mol. Its IUPAC name is N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine.
Molecular Properties
| Compound Name | N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine |
| PubChem CID | 71525990 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine |
| SMILES | COc1ccc(Nc2cc(-c3ccccc3)nn3ccnc23)nc1OC |
| InChI | InChI=1S/C19H17N5O2/c1-25-16-8-9-17(22-19(16)26-2)21-15-12-14(13-6-4-3-5-7-13)23-24-11-10-20-18(15)24/h3-12H,1-2H3,(H,21,22) |
| InChIKey | MMPRXLIDAZSRPM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine?
The IUPAC name of N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine (CID 71525990) is N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine.
What is the SMILES notation for N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine?
The canonical SMILES for N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine is COc1ccc(Nc2cc(-c3ccccc3)nn3ccnc23)nc1OC.
What is the InChIKey of N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine?
The InChIKey is MMPRXLIDAZSRPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O2/c1-25-16-8-9-17(22-19(16)26-2)21-15-12-14(13-6-4-3-5-7-13)23-24-11-10-20-18(15)24/h3-12H,1-2H3,(H,21,22).
What are the key properties of N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine?
N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine has a molecular weight of 347.38 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dimethoxy-2-pyridinyl)-6-phenylimidazo[1,2-b]pyridazin-8-amine is sourced from PubChem (CID 71525990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).