C36H29F6N3O5 — CID 71526014
4-[3-[2-[(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-6-(dimethylamino)-3-pyridinyl]-4-methoxyphenyl]-3-methylbenzoic acid (PubChem CID 71526014) has the molecular formula C36H29F6N3O5 and a molecular weight of 697.63 g/mol. Its IUPAC name is 4-[3-[2-[(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-6-(dimethylamino)-3-pyridinyl]-4-methoxyphenyl]-3-methylbenzoic acid.
| Compound Name | 4-[3-[2-[(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-6-(dimethylamino)-3-pyridinyl]-4-methoxyphenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 71526014 |
| Molecular Formula | C36H29F6N3O5 |
| Molecular Weight | 697.63 g/mol |
| Exact Mass | 697.20 |
| IUPAC Name | 4-[3-[2-[(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-6-(dimethylamino)-3-pyridinyl]-4-methoxyphenyl]-3-methylbenzoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)O)cc2C)cc1-c1ccc(N(C)C)nc1[C@@H]1C=C[C@H]2[C@@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)OC(=O)N12 |
| InChI | InChI=1S/C36H29F6N3O5/c1-18-13-20(33(46)47)5-7-24(18)19-6-11-29(49-4)26(16-19)25-8-12-30(44(2)3)43-31(25)27-9-10-28-32(50-34(48)45(27)28)21-14-22(35(37,38)39)17-23(15-21)36(40,41)42/h5-17,27-28,32H,1-4H3,(H,46,47)/t27-,28-,32+/m0/s1 |
| InChIKey | GIBCYNOMGAIMAA-ALKXEMMNSA-N |
| XLogP | 8.71 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.63 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|