C31H28F7N3O3 — CID 71526104
(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(dimethylamino)-5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-pyridinyl]-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 71526104) has the molecular formula C31H28F7N3O3 and a molecular weight of 623.57 g/mol. Its IUPAC name is (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(dimethylamino)-5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-pyridinyl]-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(dimethylamino)-5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-pyridinyl]-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 71526104 |
| Molecular Formula | C31H28F7N3O3 |
| Molecular Weight | 623.57 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(dimethylamino)-5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-pyridinyl]-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | COc1cc(F)c(C(C)C)cc1-c1cnc(N(C)C)cc1[C@@H]1C=C[C@H]2[C@@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)OC(=O)N12 |
| InChI | InChI=1S/C31H28F7N3O3/c1-15(2)19-11-21(26(43-5)13-23(19)32)22-14-39-27(40(3)4)12-20(22)24-6-7-25-28(44-29(42)41(24)25)16-8-17(30(33,34)35)10-18(9-16)31(36,37)38/h6-15,24-25,28H,1-5H3/t24-,25-,28+/m0/s1 |
| InChIKey | HUCXOQZHDOLEFK-PNIUZAESSA-N |
| XLogP | 8.30 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.57 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|