C28H33FN4O4 — CID 71526559
4-[[6-fluoro-3-[[4-(2-methoxyethyl)piperazin-1-yl]methyl]-4-oxo-2,3-dihydro-1H-carbazol-9-yl]methyl]-N-hydroxybenzamide (PubChem CID 71526559) has the molecular formula C28H33FN4O4 and a molecular weight of 508.59 g/mol. Its IUPAC name is 4-[[6-fluoro-3-[[4-(2-methoxyethyl)piperazin-1-yl]methyl]-4-oxo-2,3-dihydro-1H-carbazol-9-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[6-fluoro-3-[[4-(2-methoxyethyl)piperazin-1-yl]methyl]-4-oxo-2,3-dihydro-1H-carbazol-9-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 71526559 |
| Molecular Formula | C28H33FN4O4 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 4-[[6-fluoro-3-[[4-(2-methoxyethyl)piperazin-1-yl]methyl]-4-oxo-2,3-dihydro-1H-carbazol-9-yl]methyl]-N-hydroxybenzamide |
| SMILES | COCCN1CCN(CC2CCc3c(c4cc(F)ccc4n3Cc3ccc(C(=O)NO)cc3)C2=O)CC1 |
| InChI | InChI=1S/C28H33FN4O4/c1-37-15-14-31-10-12-32(13-11-31)18-21-6-8-25-26(27(21)34)23-16-22(29)7-9-24(23)33(25)17-19-2-4-20(5-3-19)28(35)30-36/h2-5,7,9,16,21,36H,6,8,10-15,17-18H2,1H3,(H,30,35) |
| InChIKey | MJCVHMKYMMAKON-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|