C19H19ClN4O3 — CID 71526566
2-[(3R,6R)-1-(2-chloro-6-methoxypyridine-3-carbonyl)-6-methylpiperidin-3-yl]oxypyridine-4-carbonitrile (PubChem CID 71526566) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-[(3R,6R)-1-(2-chloro-6-methoxypyridine-3-carbonyl)-6-methylpiperidin-3-yl]oxypyridine-4-carbonitrile.
| Compound Name | 2-[(3R,6R)-1-(2-chloro-6-methoxypyridine-3-carbonyl)-6-methylpiperidin-3-yl]oxypyridine-4-carbonitrile |
|---|---|
| PubChem CID | 71526566 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[(3R,6R)-1-(2-chloro-6-methoxypyridine-3-carbonyl)-6-methylpiperidin-3-yl]oxypyridine-4-carbonitrile |
| SMILES | COc1ccc(C(=O)N2C[C@H](Oc3cc(C#N)ccn3)CC[C@H]2C)c(Cl)n1 |
| InChI | InChI=1S/C19H19ClN4O3/c1-12-3-4-14(27-17-9-13(10-21)7-8-22-17)11-24(12)19(25)15-5-6-16(26-2)23-18(15)20/h5-9,12,14H,3-4,11H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | PDAHPFXIZOIXET-TZMCWYRMSA-N |
| XLogP | 3.08 |
| TPSA | 88.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|