C13H23N6O7P — CID 71526612
[(2R,3R,4R,5S)-4-[3-(diaminomethylideneamino)propoxy]-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxyphosphonamidous acid (PubChem CID 71526612) has the molecular formula C13H23N6O7P and a molecular weight of 406.34 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4-[3-(diaminomethylideneamino)propoxy]-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxyphosphonamidous acid.
| Compound Name | [(2R,3R,4R,5S)-4-[3-(diaminomethylideneamino)propoxy]-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxyphosphonamidous acid |
|---|---|
| PubChem CID | 71526612 |
| Molecular Formula | C13H23N6O7P |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [(2R,3R,4R,5S)-4-[3-(diaminomethylideneamino)propoxy]-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxyphosphonamidous acid |
| SMILES | NC(N)=NCCCO[C@@H]1[C@H](O)[C@@H](COP(N)O)O[C@@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H23N6O7P/c14-12(15)17-3-1-5-24-10-9(21)7(6-25-27(16)23)26-11(10)19-4-2-8(20)18-13(19)22/h2,4,7,9-11,21,23H,1,3,5-6,16H2,(H4,14,15,17)(H,18,20,22)/t7-,9-,10-,11+,27?/m1/s1 |
| InChIKey | WPGMBYSFTCGVAN-IPJBBTDQSA-N |
| XLogP | -2.96 |
| TPSA | 213.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|