About 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride
5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride (PubChem CID 71526745) has the molecular formula C20H25Br2ClN2
and a molecular weight of 488.70 g/mol. Its IUPAC name is 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride.
Molecular Properties
| Compound Name | 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride |
| PubChem CID | 71526745 |
| Molecular Formula | C20H25Br2ClN2 |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCCCCn1c2ccc(Br)cc2c2cc(Br)ccc21.[Cl-] |
| InChI | InChI=1S/C20H25Br2N2.ClH/c1-24(2,3)12-6-4-5-11-23-19-9-7-15(21)13-17(19)18-14-16(22)8-10-20(18)23;/h7-10,13-14H,4-6,11-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GYDHQSBIPOHCIM-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride?
The IUPAC name of 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride (CID 71526745) is 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride.
What is the SMILES notation for 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride?
The canonical SMILES for 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride is C[N+](C)(C)CCCCCn1c2ccc(Br)cc2c2cc(Br)ccc21.[Cl-].
What is the InChIKey of 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride?
The InChIKey is GYDHQSBIPOHCIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H25Br2N2.ClH/c1-24(2,3)12-6-4-5-11-23-19-9-7-15(21)13-17(19)18-14-16(22)8-10-20(18)23;/h7-10,13-14H,4-6,11-12H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride?
5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride has a molecular weight of 488.70 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride is sourced from PubChem (CID 71526745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).