About (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one
(6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 71526900) has the molecular formula C8H8ClFO
and a molecular weight of 174.60 g/mol. Its IUPAC name is (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one |
| PubChem CID | 71526900 |
| Molecular Formula | C8H8ClFO |
| Molecular Weight | 174.60 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | CC1=C(Cl)C=CC(=O)[C@]1(C)F |
| InChI | InChI=1S/C8H8ClFO/c1-5-6(9)3-4-7(11)8(5,2)10/h3-4H,1-2H3/t8-/m1/s1 |
| InChIKey | CYPZYPXKAQAKOM-MRVPVSSYSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one?
The IUPAC name of (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one (CID 71526900) is (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one?
The canonical SMILES for (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one is CC1=C(Cl)C=CC(=O)[C@]1(C)F.
What is the InChIKey of (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one?
The InChIKey is CYPZYPXKAQAKOM-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H8ClFO/c1-5-6(9)3-4-7(11)8(5,2)10/h3-4H,1-2H3/t8-/m1/s1.
What are the key properties of (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one?
(6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one has a molecular weight of 174.60 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4-chloro-6-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 71526900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).