About [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate
[2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 71527079) has the molecular formula C21H20F3NO3S
and a molecular weight of 423.46 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate |
| PubChem CID | 71527079 |
| Molecular Formula | C21H20F3NO3S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | Cc1ccc(C(OS(=O)(=O)c2cccc3c(N(C)C)cccc23)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F3NO3S/c1-14-10-12-15(13-11-14)20(21(22,23)24)28-29(26,27)19-9-5-6-16-17(19)7-4-8-18(16)25(2)3/h4-13,20H,1-3H3 |
| InChIKey | PPCIFSHLGVQXGO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate?
The IUPAC name of [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate (CID 71527079) is [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate.
What is the SMILES notation for [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate?
The canonical SMILES for [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate is Cc1ccc(C(OS(=O)(=O)c2cccc3c(N(C)C)cccc23)C(F)(F)F)cc1.
What is the InChIKey of [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate?
The InChIKey is PPCIFSHLGVQXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3NO3S/c1-14-10-12-15(13-11-14)20(21(22,23)24)28-29(26,27)19-9-5-6-16-17(19)7-4-8-18(16)25(2)3/h4-13,20H,1-3H3.
What are the key properties of [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate?
[2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate has a molecular weight of 423.46 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2,2-trifluoro-1-(4-methylphenyl)ethyl] 5-(dimethylamino)naphthalene-1-sulfonate is sourced from PubChem (CID 71527079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).