C23H26O3 — CID 71527113
(8R,9R)-9-(4-methylphenyl)-8-[1-(4-methylphenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane (PubChem CID 71527113) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (8R,9R)-9-(4-methylphenyl)-8-[1-(4-methylphenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | (8R,9R)-9-(4-methylphenyl)-8-[1-(4-methylphenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 71527113 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (8R,9R)-9-(4-methylphenyl)-8-[1-(4-methylphenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane |
| SMILES | C=C(c1ccc(C)cc1)[C@H]1OOC2(CCCC2)O[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H26O3/c1-16-6-10-19(11-7-16)18(3)21-22(20-12-8-17(2)9-13-20)24-23(26-25-21)14-4-5-15-23/h6-13,21-22H,3-5,14-15H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | MBYVZBQFDMNAMG-FGZHOGPDSA-N |
| XLogP | 5.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|