C18H20FN5 — CID 71527117
4-N-[6-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]cyclohexane-1,4-diamine (PubChem CID 71527117) has the molecular formula C18H20FN5 and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-N-[6-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[6-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 71527117 |
| Molecular Formula | C18H20FN5 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-N-[6-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2cc(-c3c[nH]c4ncccc34)cc(F)n2)CC1 |
| InChI | InChI=1S/C18H20FN5/c19-16-8-11(15-10-22-18-14(15)2-1-7-21-18)9-17(24-16)23-13-5-3-12(20)4-6-13/h1-2,7-10,12-13H,3-6,20H2,(H,21,22)(H,23,24) |
| InChIKey | MIFVWYJSKVADTR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|