C28H32O5 — CID 71527348
(5R,6R)-5-(4-methoxyphenyl)-6-[1-(4-methoxyphenyl)ethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] (PubChem CID 71527348) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is (5R,6R)-5-(4-methoxyphenyl)-6-[1-(4-methoxyphenyl)ethenyl]spiro[1,2,4-trioxane-3,2'-adamantane].
| Compound Name | (5R,6R)-5-(4-methoxyphenyl)-6-[1-(4-methoxyphenyl)ethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] |
|---|---|
| PubChem CID | 71527348 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (5R,6R)-5-(4-methoxyphenyl)-6-[1-(4-methoxyphenyl)ethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] |
| SMILES | C=C(c1ccc(OC)cc1)[C@H]1OOC2(O[C@@H]1c1ccc(OC)cc1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C28H32O5/c1-17(20-4-8-24(29-2)9-5-20)26-27(21-6-10-25(30-3)11-7-21)31-28(33-32-26)22-13-18-12-19(15-22)16-23(28)14-18/h4-11,18-19,22-23,26-27H,1,12-16H2,2-3H3/t18?,19?,22?,23?,26-,27-,28?/m1/s1 |
| InChIKey | CKXMJCZXQAASLI-JTGLQJLHSA-N |
| XLogP | 5.96 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|