C26H46O4Si — CID 71527502
2-[(1R,2R,3S,8R,10E,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethoxy-10-methyl-15-oxatricyclo[6.6.1.02,7]pentadeca-6,10-dien-3-yl]propan-2-ol (PubChem CID 71527502) has the molecular formula C26H46O4Si and a molecular weight of 450.74 g/mol. Its IUPAC name is 2-[(1R,2R,3S,8R,10E,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethoxy-10-methyl-15-oxatricyclo[6.6.1.02,7]pentadeca-6,10-dien-3-yl]propan-2-ol.
| Compound Name | 2-[(1R,2R,3S,8R,10E,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethoxy-10-methyl-15-oxatricyclo[6.6.1.02,7]pentadeca-6,10-dien-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 71527502 |
| Molecular Formula | C26H46O4Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 2-[(1R,2R,3S,8R,10E,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethoxy-10-methyl-15-oxatricyclo[6.6.1.02,7]pentadeca-6,10-dien-3-yl]propan-2-ol |
| SMILES | CCOC1=C2[C@H]([C@H]3O[C@@H]2C/C(C)=C\CC[C@@H]3O[Si](C)(C)C(C)(C)C)[C@@H](C(C)(C)O)CC1 |
| InChI | InChI=1S/C26H46O4Si/c1-10-28-19-15-14-18(26(6,7)27)22-23(19)21-16-17(2)12-11-13-20(24(22)29-21)30-31(8,9)25(3,4)5/h12,18,20-22,24,27H,10-11,13-16H2,1-9H3/b17-12-/t18-,20-,21+,22+,24-/m0/s1 |
| InChIKey | KLILFKNYAFURDV-REXNWTESSA-N |
| XLogP | 6.36 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|