C37H31N3O5 — CID 71528018
[(2R,3S,5R)-3-(4-methylbenzoyl)oxy-5-(4-phenanthren-9-yltriazol-1-yl)oxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 71528018) has the molecular formula C37H31N3O5 and a molecular weight of 597.67 g/mol. Its IUPAC name is [(2R,3S,5R)-3-(4-methylbenzoyl)oxy-5-(4-phenanthren-9-yltriazol-1-yl)oxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,5R)-3-(4-methylbenzoyl)oxy-5-(4-phenanthren-9-yltriazol-1-yl)oxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 71528018 |
| Molecular Formula | C37H31N3O5 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | [(2R,3S,5R)-3-(4-methylbenzoyl)oxy-5-(4-phenanthren-9-yltriazol-1-yl)oxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@H](n3cc(-c4cc5ccccc5c5ccccc45)nn3)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H31N3O5/c1-23-11-15-25(16-12-23)36(41)43-22-34-33(45-37(42)26-17-13-24(2)14-18-26)20-35(44-34)40-21-32(38-39-40)31-19-27-7-3-4-8-28(27)29-9-5-6-10-30(29)31/h3-19,21,33-35H,20,22H2,1-2H3/t33-,34+,35+/m0/s1 |
| InChIKey | WKYAFKNPZMWEPI-BMPTZRATSA-N |
| XLogP | 7.24 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|