C27H34BF2N3O — CID 71528209
2,2-difluoro-4,6,10,12-tetramethyl-8-[4-(3-piperidin-1-ylpropoxy)phenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71528209) has the molecular formula C27H34BF2N3O and a molecular weight of 465.40 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetramethyl-8-[4-(3-piperidin-1-ylpropoxy)phenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-[4-(3-piperidin-1-ylpropoxy)phenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71528209 |
| Molecular Formula | C27H34BF2N3O |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-[4-(3-piperidin-1-ylpropoxy)phenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccc(OCCCN3CCCCC3)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C27H34BF2N3O/c1-19-17-21(3)32-26(19)25(27-20(2)18-22(4)33(27)28(32,29)30)23-9-11-24(12-10-23)34-16-8-15-31-13-6-5-7-14-31/h9-12,17-18H,5-8,13-16H2,1-4H3 |
| InChIKey | HPRWHXGAJGUOCP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 20.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|