C24H42O3Si — CID 71528233
[(2E,4E,6R,7R,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethyldodeca-2,4,8,10-tetraenyl] acetate (PubChem CID 71528233) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is [(2E,4E,6R,7R,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethyldodeca-2,4,8,10-tetraenyl] acetate.
| Compound Name | [(2E,4E,6R,7R,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethyldodeca-2,4,8,10-tetraenyl] acetate |
|---|---|
| PubChem CID | 71528233 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | [(2E,4E,6R,7R,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethyldodeca-2,4,8,10-tetraenyl] acetate |
| SMILES | C/C=C(C)/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C=C/COC(C)=O |
| InChI | InChI=1S/C24H42O3Si/c1-12-18(2)16-20(4)23(27-28(10,11)24(7,8)9)21(5)17-19(3)14-13-15-26-22(6)25/h12-14,16-17,21,23H,15H2,1-11H3/b14-13+,18-12+,19-17+,20-16+/t21-,23+/m1/s1 |
| InChIKey | DQGQOYGJJKJBKH-QYKRFABVSA-N |
| XLogP | 6.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|