C28H48O4Si — CID 71528350
[(2E,5E,7E,9R,10R,11E,13E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,9,11,13-pentamethylpentadeca-2,5,7,11,13-pentaenyl] methyl carbonate (PubChem CID 71528350) has the molecular formula C28H48O4Si and a molecular weight of 476.77 g/mol. Its IUPAC name is [(2E,5E,7E,9R,10R,11E,13E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,9,11,13-pentamethylpentadeca-2,5,7,11,13-pentaenyl] methyl carbonate.
| Compound Name | [(2E,5E,7E,9R,10R,11E,13E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,9,11,13-pentamethylpentadeca-2,5,7,11,13-pentaenyl] methyl carbonate |
|---|---|
| PubChem CID | 71528350 |
| Molecular Formula | C28H48O4Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | [(2E,5E,7E,9R,10R,11E,13E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,9,11,13-pentamethylpentadeca-2,5,7,11,13-pentaenyl] methyl carbonate |
| SMILES | C/C=C(C)/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C=C/C/C(C)=C/COC(=O)OC |
| InChI | InChI=1S/C28H48O4Si/c1-13-21(2)19-24(5)26(32-33(11,12)28(7,8)9)25(6)20-23(4)16-14-15-22(3)17-18-31-27(29)30-10/h13-14,16-17,19-20,25-26H,15,18H2,1-12H3/b16-14+,21-13+,22-17+,23-20+,24-19+/t25-,26+/m1/s1 |
| InChIKey | BXZZEUCCSPVGQS-WLFPRTFFSA-N |
| XLogP | 8.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|