About N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide
N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide (PubChem CID 71528436) has the molecular formula C16H18N2OS
and a molecular weight of 286.40 g/mol. Its IUPAC name is N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide |
| PubChem CID | 71528436 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide |
| SMILES | CN(C(=O)C1CCCC1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H18N2OS/c1-18(15(19)13-9-5-6-10-13)16-17-14(11-20-16)12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3 |
| InChIKey | PNPFGWRAVRGJTA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide?
The IUPAC name of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide (CID 71528436) is N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide.
What is the SMILES notation for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide?
The canonical SMILES for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide is CN(C(=O)C1CCCC1)c1nc(-c2ccccc2)cs1.
What is the InChIKey of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide?
The InChIKey is PNPFGWRAVRGJTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2OS/c1-18(15(19)13-9-5-6-10-13)16-17-14(11-20-16)12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3.
What are the key properties of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide?
N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide has a molecular weight of 286.40 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide is sourced from PubChem (CID 71528436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).