C26H44O3Si — CID 71528534
tert-butyl-[[(1R,6S,7R,8R,9S,12E)-3-ethoxy-13-methyl-6-prop-1-en-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-2,12-dien-9-yl]oxy]-dimethylsilane (PubChem CID 71528534) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is tert-butyl-[[(1R,6S,7R,8R,9S,12E)-3-ethoxy-13-methyl-6-prop-1-en-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-2,12-dien-9-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,6S,7R,8R,9S,12E)-3-ethoxy-13-methyl-6-prop-1-en-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-2,12-dien-9-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 71528534 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | tert-butyl-[[(1R,6S,7R,8R,9S,12E)-3-ethoxy-13-methyl-6-prop-1-en-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-2,12-dien-9-yl]oxy]-dimethylsilane |
| SMILES | C=C(C)[C@H]1CCC(OCC)=C2[C@@H]1[C@H]1O[C@@H]2C/C(C)=C\CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O3Si/c1-10-27-20-15-14-19(17(2)3)23-24(20)22-16-18(4)12-11-13-21(25(23)28-22)29-30(8,9)26(5,6)7/h12,19,21-23,25H,2,10-11,13-16H2,1,3-9H3/b18-12-/t19-,21+,22-,23-,25+/m1/s1 |
| InChIKey | XIHYCIDWIAFQPV-SSNIDNHNSA-N |
| XLogP | 7.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|