About [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium
[(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium (PubChem CID 7152858) has the molecular formula C6H12ClF3N+
and a molecular weight of 190.62 g/mol. Its IUPAC name is [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium.
Molecular Properties
| Compound Name | [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium |
| PubChem CID | 7152858 |
| Molecular Formula | C6H12ClF3N+ |
| Molecular Weight | 190.62 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium |
| SMILES | CC[NH+](CC)C(F)(F)[C@H](F)Cl |
| InChI | InChI=1S/C6H11ClF3N/c1-3-11(4-2)6(9,10)5(7)8/h5H,3-4H2,1-2H3/p+1/t5-/m0/s1 |
| InChIKey | BDZHKUAKSMWSAJ-YFKPBYRVSA-O |
| XLogP | 1.04 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.62 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium?
The IUPAC name of [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium (CID 7152858) is [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium.
What is the SMILES notation for [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium?
The canonical SMILES for [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium is CC[NH+](CC)C(F)(F)[C@H](F)Cl.
What is the InChIKey of [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium?
The InChIKey is BDZHKUAKSMWSAJ-YFKPBYRVSA-O. The full InChI is InChI=1S/C6H11ClF3N/c1-3-11(4-2)6(9,10)5(7)8/h5H,3-4H2,1-2H3/p+1/t5-/m0/s1.
What are the key properties of [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium?
[(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium has a molecular weight of 190.62 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-chloro-1,1,2-trifluoroethyl]-diethylazanium is sourced from PubChem (CID 7152858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).