C12H16O4 — CID 71528813
(4R,5E,9E,12R)-4-hydroxy-12-methyl-1-oxacyclododeca-5,9-diene-2,8-dione (PubChem CID 71528813) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (4R,5E,9E,12R)-4-hydroxy-12-methyl-1-oxacyclododeca-5,9-diene-2,8-dione.
| Compound Name | (4R,5E,9E,12R)-4-hydroxy-12-methyl-1-oxacyclododeca-5,9-diene-2,8-dione |
|---|---|
| PubChem CID | 71528813 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (4R,5E,9E,12R)-4-hydroxy-12-methyl-1-oxacyclododeca-5,9-diene-2,8-dione |
| SMILES | C[C@@H]1C/C=C/C(=O)C/C=C/[C@H](O)CC(=O)O1 |
| InChI | InChI=1S/C12H16O4/c1-9-4-2-5-10(13)6-3-7-11(14)8-12(15)16-9/h2-3,5,7,9,11,14H,4,6,8H2,1H3/b5-2+,7-3+/t9-,11+/m1/s1 |
| InChIKey | BKNQGBKAJUUPBQ-WLFRFXDNSA-N |
| XLogP | 1.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|