C16H26O5 — CID 71528821
1-[(1R,2R,4aS,6S,8S,8aS)-2,4a,8-trihydroxy-1,2,6-trimethyl-6,7,8,8a-tetrahydro-5H-naphthalen-1-yl]-3-hydroxypropan-1-one (PubChem CID 71528821) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-[(1R,2R,4aS,6S,8S,8aS)-2,4a,8-trihydroxy-1,2,6-trimethyl-6,7,8,8a-tetrahydro-5H-naphthalen-1-yl]-3-hydroxypropan-1-one.
| Compound Name | 1-[(1R,2R,4aS,6S,8S,8aS)-2,4a,8-trihydroxy-1,2,6-trimethyl-6,7,8,8a-tetrahydro-5H-naphthalen-1-yl]-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 71528821 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-[(1R,2R,4aS,6S,8S,8aS)-2,4a,8-trihydroxy-1,2,6-trimethyl-6,7,8,8a-tetrahydro-5H-naphthalen-1-yl]-3-hydroxypropan-1-one |
| SMILES | C[C@H]1C[C@H](O)[C@H]2[C@@](O)(C=C[C@@](C)(O)[C@]2(C)C(=O)CCO)C1 |
| InChI | InChI=1S/C16H26O5/c1-10-8-11(18)13-15(3,12(19)4-7-17)14(2,20)5-6-16(13,21)9-10/h5-6,10-11,13,17-18,20-21H,4,7-9H2,1-3H3/t10-,11-,13+,14+,15+,16+/m0/s1 |
| InChIKey | XLPZAZKGKJAESI-MTBPCUBESA-N |
| XLogP | 0.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|