About 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one
6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one (PubChem CID 71529562) has the molecular formula C25H28N4O3
and a molecular weight of 432.52 g/mol. Its IUPAC name is 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one |
| PubChem CID | 71529562 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one |
| SMILES | CCN(CC)CCOc1ccc(N2Cc3cnc(-c4ccccc4)nc3C2=O)cc1OC |
| InChI | InChI=1S/C25H28N4O3/c1-4-28(5-2)13-14-32-21-12-11-20(15-22(21)31-3)29-17-19-16-26-24(27-23(19)25(29)30)18-9-7-6-8-10-18/h6-12,15-16H,4-5,13-14,17H2,1-3H3 |
| InChIKey | MGYQMAMYGNRTKC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one?
The IUPAC name of 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one (CID 71529562) is 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one.
What is the SMILES notation for 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one?
The canonical SMILES for 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one is CCN(CC)CCOc1ccc(N2Cc3cnc(-c4ccccc4)nc3C2=O)cc1OC.
What is the InChIKey of 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one?
The InChIKey is MGYQMAMYGNRTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N4O3/c1-4-28(5-2)13-14-32-21-12-11-20(15-22(21)31-3)29-17-19-16-26-24(27-23(19)25(29)30)18-9-7-6-8-10-18/h6-12,15-16H,4-5,13-14,17H2,1-3H3.
What are the key properties of 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one?
6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one has a molecular weight of 432.52 g/mol, XLogP of 4.03, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenyl-5H-pyrrolo[3,4-d]pyrimidin-7-one is sourced from PubChem (CID 71529562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).