C20H19N5O4S — CID 71529590
methyl 9-(3,4,5-trimethoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 71529590) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is methyl 9-(3,4,5-trimethoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
| Compound Name | methyl 9-(3,4,5-trimethoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
|---|---|
| PubChem CID | 71529590 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | methyl 9-(3,4,5-trimethoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OC)c1nc2ccc3ncnc(Nc4cc(OC)c(OC)c(OC)c4)c3c2s1 |
| InChI | InChI=1S/C20H19N5O4S/c1-26-13-7-10(8-14(27-2)16(13)28-3)24-19-15-11(22-9-23-19)5-6-12-17(15)30-20(25-12)18(21)29-4/h5-9,21H,1-4H3,(H,22,23,24)/b21-18- |
| InChIKey | SCSFTOHNPKDROT-UZYVYHOESA-N |
| XLogP | 3.98 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|