C20H17Cl2N5OS — CID 71529633
butyl 9-(2,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 71529633) has the molecular formula C20H17Cl2N5OS and a molecular weight of 446.36 g/mol. Its IUPAC name is butyl 9-(2,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
| Compound Name | butyl 9-(2,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
|---|---|
| PubChem CID | 71529633 |
| Molecular Formula | C20H17Cl2N5OS |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | butyl 9-(2,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OCCCC)c1nc2ccc3ncnc(Nc4ccc(Cl)cc4Cl)c3c2s1 |
| InChI | InChI=1S/C20H17Cl2N5OS/c1-2-3-8-28-18(23)20-27-15-7-6-14-16(17(15)29-20)19(25-10-24-14)26-13-5-4-11(21)9-12(13)22/h4-7,9-10,23H,2-3,8H2,1H3,(H,24,25,26)/b23-18- |
| InChIKey | CIGFCAJNHRIRIV-NKFKGCMQSA-N |
| XLogP | 6.43 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|