C24H27N7OS — CID 71529722
9-(4-methoxyanilino)-N'-(2-piperidin-1-ylethyl)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide (PubChem CID 71529722) has the molecular formula C24H27N7OS and a molecular weight of 461.60 g/mol. Its IUPAC name is 9-(4-methoxyanilino)-N'-(2-piperidin-1-ylethyl)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide.
| Compound Name | 9-(4-methoxyanilino)-N'-(2-piperidin-1-ylethyl)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide |
|---|---|
| PubChem CID | 71529722 |
| Molecular Formula | C24H27N7OS |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 9-(4-methoxyanilino)-N'-(2-piperidin-1-ylethyl)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide |
| SMILES | COc1ccc(Nc2ncnc3ccc4nc(/C(N)=N/CCN5CCCCC5)sc4c23)cc1 |
| InChI | InChI=1S/C24H27N7OS/c1-32-17-7-5-16(6-8-17)29-23-20-18(27-15-28-23)9-10-19-21(20)33-24(30-19)22(25)26-11-14-31-12-3-2-4-13-31/h5-10,15H,2-4,11-14H2,1H3,(H2,25,26)(H,27,28,29) |
| InChIKey | SWJQLQZBSDBAPL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|