C17H11Cl2N5OS — CID 71529771
methyl 9-(3,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 71529771) has the molecular formula C17H11Cl2N5OS and a molecular weight of 404.28 g/mol. Its IUPAC name is methyl 9-(3,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
| Compound Name | methyl 9-(3,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
|---|---|
| PubChem CID | 71529771 |
| Molecular Formula | C17H11Cl2N5OS |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | methyl 9-(3,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OC)c1nc2ccc3ncnc(Nc4ccc(Cl)c(Cl)c4)c3c2s1 |
| InChI | InChI=1S/C17H11Cl2N5OS/c1-25-15(20)17-24-12-5-4-11-13(14(12)26-17)16(22-7-21-11)23-8-2-3-9(18)10(19)6-8/h2-7,20H,1H3,(H,21,22,23)/b20-15- |
| InChIKey | AYALTLXRNITQHK-HKWRFOASSA-N |
| XLogP | 5.26 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|